C27H30NO3+ — CID 67496127
[(3R)-1-(3-cyclopropylprop-2-ynyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-diphenylacetate (PubChem CID 67496127) has the molecular formula C27H30NO3+ and a molecular weight of 416.54 g/mol. Its IUPAC name is [(3R)-1-(3-cyclopropylprop-2-ynyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-diphenylacetate.
| Compound Name | [(3R)-1-(3-cyclopropylprop-2-ynyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-diphenylacetate |
|---|---|
| PubChem CID | 67496127 |
| Molecular Formula | C27H30NO3+ |
| Molecular Weight | 416.54 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | [(3R)-1-(3-cyclopropylprop-2-ynyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-diphenylacetate |
| SMILES | O=C(O[C@H]1C[N+]2(CC#CC3CC3)CCC1CC2)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H30NO3/c29-26(27(30,23-9-3-1-4-10-23)24-11-5-2-6-12-24)31-25-20-28(17-7-8-21-13-14-21)18-15-22(25)16-19-28/h1-6,9-12,21-22,25,30H,13-20H2/q+1/t22?,25-,28?/m0/s1 |
| InChIKey | RMUUCOAJGCGRTO-OKBRVIPFSA-N |
| XLogP | 3.49 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.54 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|