C31H36NO4+ — CID 140844397
[1-(3-phenylmethoxypropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-diphenylacetate (PubChem CID 140844397) has the molecular formula C31H36NO4+ and a molecular weight of 486.63 g/mol. Its IUPAC name is [1-(3-phenylmethoxypropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-diphenylacetate.
| Compound Name | [1-(3-phenylmethoxypropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-diphenylacetate |
|---|---|
| PubChem CID | 140844397 |
| Molecular Formula | C31H36NO4+ |
| Molecular Weight | 486.63 g/mol |
| Exact Mass | 486.26 |
| IUPAC Name | [1-(3-phenylmethoxypropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-diphenylacetate |
| SMILES | O=C(OC1C[N+]2(CCCOCc3ccccc3)CCC1CC2)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H36NO4/c33-30(31(34,27-13-6-2-7-14-27)28-15-8-3-9-16-28)36-29-23-32(20-17-26(29)18-21-32)19-10-22-35-24-25-11-4-1-5-12-25/h1-9,11-16,26,29,34H,10,17-24H2/q+1 |
| InChIKey | AIMDAESTPOXUBL-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.63 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|