C31H33F3NO4+ — CID 155542840
[1-[3-[4-(trifluoromethoxy)phenyl]propyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-diphenylacetate (PubChem CID 155542840) has the molecular formula C31H33F3NO4+ and a molecular weight of 540.60 g/mol. Its IUPAC name is [1-[3-[4-(trifluoromethoxy)phenyl]propyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-diphenylacetate.
| Compound Name | [1-[3-[4-(trifluoromethoxy)phenyl]propyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-diphenylacetate |
|---|---|
| PubChem CID | 155542840 |
| Molecular Formula | C31H33F3NO4+ |
| Molecular Weight | 540.60 g/mol |
| Exact Mass | 540.24 |
| IUPAC Name | [1-[3-[4-(trifluoromethoxy)phenyl]propyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-diphenylacetate |
| SMILES | O=C(OC1C[N+]2(CCCc3ccc(OC(F)(F)F)cc3)CCC1CC2)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H33F3NO4/c32-31(33,34)39-27-15-13-23(14-16-27)8-7-19-35-20-17-24(18-21-35)28(22-35)38-29(36)30(37,25-9-3-1-4-10-25)26-11-5-2-6-12-26/h1-6,9-16,24,28,37H,7-8,17-22H2/q+1 |
| InChIKey | DUUCBMCTCKTDOL-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.60 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|