C31H36BrNO5 — CID 161284963
[1-[3-(4-methoxyphenoxy)propyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-diphenylacetate bromide (PubChem CID 161284963) has the molecular formula C31H36BrNO5 and a molecular weight of 582.54 g/mol. Its IUPAC name is [1-[3-(4-methoxyphenoxy)propyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-diphenylacetate bromide.
| Compound Name | [1-[3-(4-methoxyphenoxy)propyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-diphenylacetate bromide |
|---|---|
| PubChem CID | 161284963 |
| Molecular Formula | C31H36BrNO5 |
| Molecular Weight | 582.54 g/mol |
| Exact Mass | 581.18 |
| IUPAC Name | [1-[3-(4-methoxyphenoxy)propyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-diphenylacetate bromide |
| SMILES | COc1ccc(OCCC[N+]23CCC(CC2)C(OC(=O)C(O)(c2ccccc2)c2ccccc2)C3)cc1.[Br-] |
| InChI | InChI=1S/C31H36NO5.BrH/c1-35-27-13-15-28(16-14-27)36-22-8-19-32-20-17-24(18-21-32)29(23-32)37-30(33)31(34,25-9-4-2-5-10-25)26-11-6-3-7-12-26;/h2-7,9-16,24,29,34H,8,17-23H2,1H3;1H/q+1;/p-1 |
| InChIKey | FGYGYZVLRTYGQR-UHFFFAOYSA-M |
| XLogP | 1.56 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.54 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|