C33H39N2O6+ — CID 67497081
[(3R)-1-[3-[(3,5-dimethoxybenzoyl)amino]propyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-diphenylacetate (PubChem CID 67497081) has the molecular formula C33H39N2O6+ and a molecular weight of 559.68 g/mol. Its IUPAC name is [(3R)-1-[3-[(3,5-dimethoxybenzoyl)amino]propyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-diphenylacetate.
| Compound Name | [(3R)-1-[3-[(3,5-dimethoxybenzoyl)amino]propyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-diphenylacetate |
|---|---|
| PubChem CID | 67497081 |
| Molecular Formula | C33H39N2O6+ |
| Molecular Weight | 559.68 g/mol |
| Exact Mass | 559.28 |
| IUPAC Name | [(3R)-1-[3-[(3,5-dimethoxybenzoyl)amino]propyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-diphenylacetate |
| SMILES | COc1cc(OC)cc(C(=O)NCCC[N+]23CCC(CC2)[C@@H](OC(=O)C(O)(c2ccccc2)c2ccccc2)C3)c1 |
| InChI | InChI=1S/C33H38N2O6/c1-39-28-20-25(21-29(22-28)40-2)31(36)34-16-9-17-35-18-14-24(15-19-35)30(23-35)41-32(37)33(38,26-10-5-3-6-11-26)27-12-7-4-8-13-27/h3-8,10-13,20-22,24,30,38H,9,14-19,23H2,1-2H3/p+1/t24?,30-,35?/m0/s1 |
| InChIKey | RKYNMNYUWXAMKU-VKCFSFPUSA-O |
| XLogP | 3.91 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.68 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|