C34H34F6N2O6 — CID 87422503
2,2,2-trifluoroacetate;[(3R)-1-[3-[[2-(trifluoromethyl)benzoyl]amino]propyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-diphenylacetate (PubChem CID 87422503) has the molecular formula C34H34F6N2O6 and a molecular weight of 680.64 g/mol. Its IUPAC name is 2,2,2-trifluoroacetate;[(3R)-1-[3-[[2-(trifluoromethyl)benzoyl]amino]propyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-diphenylacetate.
| Compound Name | 2,2,2-trifluoroacetate;[(3R)-1-[3-[[2-(trifluoromethyl)benzoyl]amino]propyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-diphenylacetate |
|---|---|
| PubChem CID | 87422503 |
| Molecular Formula | C34H34F6N2O6 |
| Molecular Weight | 680.64 g/mol |
| Exact Mass | 680.23 |
| IUPAC Name | 2,2,2-trifluoroacetate;[(3R)-1-[3-[[2-(trifluoromethyl)benzoyl]amino]propyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-diphenylacetate |
| SMILES | O=C(NCCC[N+]12CCC(CC1)[C@@H](OC(=O)C(O)(c1ccccc1)c1ccccc1)C2)c1ccccc1C(F)(F)F.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C32H33F3N2O4.C2HF3O2/c33-32(34,35)27-15-8-7-14-26(27)29(38)36-18-9-19-37-20-16-23(17-21-37)28(22-37)41-30(39)31(40,24-10-3-1-4-11-24)25-12-5-2-6-13-25;3-2(4,5)1(6)7/h1-8,10-15,23,28,40H,9,16-22H2;(H,6,7)/t23?,28-,37?;/m0./s1 |
| InChIKey | DFFMWQSIYSJMFO-WGYOFOBQSA-N |
| XLogP | 4.21 |
| TPSA | 115.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.64 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|