C31H34ClN2O4+ — CID 11410031
[1-[3-[(4-chlorobenzoyl)amino]propyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-diphenylacetate (PubChem CID 11410031) has the molecular formula C31H34ClN2O4+ and a molecular weight of 534.08 g/mol. Its IUPAC name is [1-[3-[(4-chlorobenzoyl)amino]propyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-diphenylacetate.
| Compound Name | [1-[3-[(4-chlorobenzoyl)amino]propyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-diphenylacetate |
|---|---|
| PubChem CID | 11410031 |
| Molecular Formula | C31H34ClN2O4+ |
| Molecular Weight | 534.08 g/mol |
| Exact Mass | 533.22 |
| IUPAC Name | [1-[3-[(4-chlorobenzoyl)amino]propyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-diphenylacetate |
| SMILES | O=C(NCCC[N+]12CCC(CC1)C(OC(=O)C(O)(c1ccccc1)c1ccccc1)C2)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C31H33ClN2O4/c32-27-14-12-24(13-15-27)29(35)33-18-7-19-34-20-16-23(17-21-34)28(22-34)38-30(36)31(37,25-8-3-1-4-9-25)26-10-5-2-6-11-26/h1-6,8-15,23,28,37H,7,16-22H2/p+1 |
| InChIKey | TYXSLYVJDNHSTP-UHFFFAOYSA-O |
| XLogP | 4.55 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.08 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|