C30H33ClN3O6S+ — CID 91244409
[(3R)-1-[2-[(4-chloro-3-sulfamoylbenzoyl)amino]ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-diphenylacetate (PubChem CID 91244409) has the molecular formula C30H33ClN3O6S+ and a molecular weight of 599.13 g/mol. Its IUPAC name is [(3R)-1-[2-[(4-chloro-3-sulfamoylbenzoyl)amino]ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-diphenylacetate.
| Compound Name | [(3R)-1-[2-[(4-chloro-3-sulfamoylbenzoyl)amino]ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-diphenylacetate |
|---|---|
| PubChem CID | 91244409 |
| Molecular Formula | C30H33ClN3O6S+ |
| Molecular Weight | 599.13 g/mol |
| Exact Mass | 598.18 |
| IUPAC Name | [(3R)-1-[2-[(4-chloro-3-sulfamoylbenzoyl)amino]ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-diphenylacetate |
| SMILES | NS(=O)(=O)c1cc(C(=O)NCC[N+]23CCC(CC2)[C@@H](OC(=O)C(O)(c2ccccc2)c2ccccc2)C3)ccc1Cl |
| InChI | InChI=1S/C30H32ClN3O6S/c31-25-12-11-22(19-27(25)41(32,38)39)28(35)33-15-18-34-16-13-21(14-17-34)26(20-34)40-29(36)30(37,23-7-3-1-4-8-23)24-9-5-2-6-10-24/h1-12,19,21,26,37H,13-18,20H2,(H2-,32,33,35,38,39)/p+1/t21?,26-,34?/m0/s1 |
| InChIKey | DTKPLNLWKIQCCR-JDTBCXLLSA-O |
| XLogP | 2.81 |
| TPSA | 135.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.13 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|