C34H37F3N2O8 — CID 67497253
[(3R)-1-[2-[(3,5-dimethoxybenzoyl)amino]ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-diphenylacetate;2,2,2-trifluoroacetate (PubChem CID 67497253) has the molecular formula C34H37F3N2O8 and a molecular weight of 658.67 g/mol. Its IUPAC name is [(3R)-1-[2-[(3,5-dimethoxybenzoyl)amino]ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-diphenylacetate;2,2,2-trifluoroacetate.
| Compound Name | [(3R)-1-[2-[(3,5-dimethoxybenzoyl)amino]ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-diphenylacetate;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 67497253 |
| Molecular Formula | C34H37F3N2O8 |
| Molecular Weight | 658.67 g/mol |
| Exact Mass | 658.25 |
| IUPAC Name | [(3R)-1-[2-[(3,5-dimethoxybenzoyl)amino]ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-diphenylacetate;2,2,2-trifluoroacetate |
| SMILES | COc1cc(OC)cc(C(=O)NCC[N+]23CCC(CC2)[C@@H](OC(=O)C(O)(c2ccccc2)c2ccccc2)C3)c1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C32H36N2O6.C2HF3O2/c1-38-27-19-24(20-28(21-27)39-2)30(35)33-15-18-34-16-13-23(14-17-34)29(22-34)40-31(36)32(37,25-9-5-3-6-10-25)26-11-7-4-8-12-26;3-2(4,5)1(6)7/h3-12,19-21,23,29,37H,13-18,22H2,1-2H3;(H,6,7)/t23?,29-,34?;/m0./s1 |
| InChIKey | QTGVAXZCQNHRDJ-STNBFCITSA-N |
| XLogP | 2.82 |
| TPSA | 134.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.67 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|