C29H33N2O5+ — CID 67496160
[(3R)-1-[2-[(3-methylfuran-2-carbonyl)amino]ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-diphenylacetate (PubChem CID 67496160) has the molecular formula C29H33N2O5+ and a molecular weight of 489.59 g/mol. Its IUPAC name is [(3R)-1-[2-[(3-methylfuran-2-carbonyl)amino]ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-diphenylacetate.
| Compound Name | [(3R)-1-[2-[(3-methylfuran-2-carbonyl)amino]ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-diphenylacetate |
|---|---|
| PubChem CID | 67496160 |
| Molecular Formula | C29H33N2O5+ |
| Molecular Weight | 489.59 g/mol |
| Exact Mass | 489.24 |
| IUPAC Name | [(3R)-1-[2-[(3-methylfuran-2-carbonyl)amino]ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-diphenylacetate |
| SMILES | Cc1ccoc1C(=O)NCC[N+]12CCC(CC1)[C@@H](OC(=O)C(O)(c1ccccc1)c1ccccc1)C2 |
| InChI | InChI=1S/C29H32N2O5/c1-21-14-19-35-26(21)27(32)30-15-18-31-16-12-22(13-17-31)25(20-31)36-28(33)29(34,23-8-4-2-5-9-23)24-10-6-3-7-11-24/h2-11,14,19,22,25,34H,12-13,15-18,20H2,1H3/p+1/t22?,25-,31?/m0/s1 |
| InChIKey | UERDVZCMPSJPKT-LMEDFRRQSA-O |
| XLogP | 3.41 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.59 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|