C29H32BrNO3 — CID 155549803
[1-(2-phenylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-diphenylacetate bromide (PubChem CID 155549803) has the molecular formula C29H32BrNO3 and a molecular weight of 522.48 g/mol. Its IUPAC name is [1-(2-phenylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-diphenylacetate bromide.
| Compound Name | [1-(2-phenylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-diphenylacetate bromide |
|---|---|
| PubChem CID | 155549803 |
| Molecular Formula | C29H32BrNO3 |
| Molecular Weight | 522.48 g/mol |
| Exact Mass | 521.16 |
| IUPAC Name | [1-(2-phenylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-diphenylacetate bromide |
| SMILES | O=C(OC1C[N+]2(CCc3ccccc3)CCC1CC2)C(O)(c1ccccc1)c1ccccc1.[Br-] |
| InChI | InChI=1S/C29H32NO3.BrH/c31-28(29(32,25-12-6-2-7-13-25)26-14-8-3-9-15-26)33-27-22-30(20-17-24(27)18-21-30)19-16-23-10-4-1-5-11-23;/h1-15,24,27,32H,16-22H2;1H/q+1;/p-1 |
| InChIKey | CRNAGJOXJZUMJM-UHFFFAOYSA-M |
| XLogP | 1.32 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.48 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|