C30H34BrNO4 — CID 10280880
[(3R)-1-(2-phenoxyethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,3-diphenylpropanoate bromide (PubChem CID 10280880) has the molecular formula C30H34BrNO4 and a molecular weight of 552.51 g/mol. Its IUPAC name is [(3R)-1-(2-phenoxyethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,3-diphenylpropanoate bromide.
| Compound Name | [(3R)-1-(2-phenoxyethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,3-diphenylpropanoate bromide |
|---|---|
| PubChem CID | 10280880 |
| Molecular Formula | C30H34BrNO4 |
| Molecular Weight | 552.51 g/mol |
| Exact Mass | 551.17 |
| IUPAC Name | [(3R)-1-(2-phenoxyethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,3-diphenylpropanoate bromide |
| SMILES | O=C(O[C@H]1C[N+]2(CCOc3ccccc3)CCC1CC2)C(O)(Cc1ccccc1)c1ccccc1.[Br-] |
| InChI | InChI=1S/C30H34NO4.BrH/c32-29(30(33,26-12-6-2-7-13-26)22-24-10-4-1-5-11-24)35-28-23-31(18-16-25(28)17-19-31)20-21-34-27-14-8-3-9-15-27;/h1-15,25,28,33H,16-23H2;1H/q+1;/p-1/t25?,28-,30?,31?;/m0./s1 |
| InChIKey | FBTLQFURBPKIKS-PTYFWYAUSA-M |
| XLogP | 1.35 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.51 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|