C30H31F3NO4+ — CID 134272436
[1-[2-[3-(trifluoromethyl)phenoxy]ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-diphenylacetate (PubChem CID 134272436) has the molecular formula C30H31F3NO4+ and a molecular weight of 526.58 g/mol. Its IUPAC name is [1-[2-[3-(trifluoromethyl)phenoxy]ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-diphenylacetate.
| Compound Name | [1-[2-[3-(trifluoromethyl)phenoxy]ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-diphenylacetate |
|---|---|
| PubChem CID | 134272436 |
| Molecular Formula | C30H31F3NO4+ |
| Molecular Weight | 526.58 g/mol |
| Exact Mass | 526.22 |
| IUPAC Name | [1-[2-[3-(trifluoromethyl)phenoxy]ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-diphenylacetate |
| SMILES | O=C(OC1C[N+]2(CCOc3cccc(C(F)(F)F)c3)CCC1CC2)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H31F3NO4/c31-30(32,33)25-12-7-13-26(20-25)37-19-18-34-16-14-22(15-17-34)27(21-34)38-28(35)29(36,23-8-3-1-4-9-23)24-10-5-2-6-11-24/h1-13,20,22,27,36H,14-19,21H2/q+1 |
| InChIKey | HMJFQRNLTYRRKW-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.58 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|