C32H37N2O6S+ — CID 11284599
[1-[3-[(2-methylsulfonylbenzoyl)amino]propyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-diphenylacetate (PubChem CID 11284599) has the molecular formula C32H37N2O6S+ and a molecular weight of 577.72 g/mol. Its IUPAC name is [1-[3-[(2-methylsulfonylbenzoyl)amino]propyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-diphenylacetate.
| Compound Name | [1-[3-[(2-methylsulfonylbenzoyl)amino]propyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-diphenylacetate |
|---|---|
| PubChem CID | 11284599 |
| Molecular Formula | C32H37N2O6S+ |
| Molecular Weight | 577.72 g/mol |
| Exact Mass | 577.24 |
| IUPAC Name | [1-[3-[(2-methylsulfonylbenzoyl)amino]propyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-diphenylacetate |
| SMILES | CS(=O)(=O)c1ccccc1C(=O)NCCC[N+]12CCC(CC1)C(OC(=O)C(O)(c1ccccc1)c1ccccc1)C2 |
| InChI | InChI=1S/C32H36N2O6S/c1-41(38,39)29-16-9-8-15-27(29)30(35)33-19-10-20-34-21-17-24(18-22-34)28(23-34)40-31(36)32(37,25-11-4-2-5-12-25)26-13-6-3-7-14-26/h2-9,11-16,24,28,37H,10,17-23H2,1H3/p+1 |
| InChIKey | WIRHKMUBPJCOOA-UHFFFAOYSA-O |
| XLogP | 3.30 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.72 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|