C32H32ClF3N2O6 — CID 67497607
[(3R)-1-[2-[(4-chlorobenzoyl)amino]ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-diphenylacetate;2,2,2-trifluoroacetate (PubChem CID 67497607) has the molecular formula C32H32ClF3N2O6 and a molecular weight of 633.06 g/mol. Its IUPAC name is [(3R)-1-[2-[(4-chlorobenzoyl)amino]ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-diphenylacetate;2,2,2-trifluoroacetate.
| Compound Name | [(3R)-1-[2-[(4-chlorobenzoyl)amino]ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-diphenylacetate;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 67497607 |
| Molecular Formula | C32H32ClF3N2O6 |
| Molecular Weight | 633.06 g/mol |
| Exact Mass | 632.19 |
| IUPAC Name | [(3R)-1-[2-[(4-chlorobenzoyl)amino]ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-diphenylacetate;2,2,2-trifluoroacetate |
| SMILES | O=C(NCC[N+]12CCC(CC1)[C@@H](OC(=O)C(O)(c1ccccc1)c1ccccc1)C2)c1ccc(Cl)cc1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C30H31ClN2O4.C2HF3O2/c31-26-13-11-23(12-14-26)28(34)32-17-20-33-18-15-22(16-19-33)27(21-33)37-29(35)30(36,24-7-3-1-4-8-24)25-9-5-2-6-10-25;3-2(4,5)1(6)7/h1-14,22,27,36H,15-21H2;(H,6,7)/t22?,27-,33?;/m0./s1 |
| InChIKey | USBAAYSKDMPVCT-PUQCJQIMSA-N |
| XLogP | 3.46 |
| TPSA | 115.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.06 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|