C32H40F3N3O6 — CID 67497882
[(3R)-1-[2-(cyclohexylcarbamoylamino)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-diphenylacetate;2,2,2-trifluoroacetate (PubChem CID 67497882) has the molecular formula C32H40F3N3O6 and a molecular weight of 619.68 g/mol. Its IUPAC name is [(3R)-1-[2-(cyclohexylcarbamoylamino)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-diphenylacetate;2,2,2-trifluoroacetate.
| Compound Name | [(3R)-1-[2-(cyclohexylcarbamoylamino)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-diphenylacetate;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 67497882 |
| Molecular Formula | C32H40F3N3O6 |
| Molecular Weight | 619.68 g/mol |
| Exact Mass | 619.29 |
| IUPAC Name | [(3R)-1-[2-(cyclohexylcarbamoylamino)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-diphenylacetate;2,2,2-trifluoroacetate |
| SMILES | O=C(NCC[N+]12CCC(CC1)[C@@H](OC(=O)C(O)(c1ccccc1)c1ccccc1)C2)NC1CCCCC1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C30H39N3O4.C2HF3O2/c34-28(30(36,24-10-4-1-5-11-24)25-12-6-2-7-13-25)37-27-22-33(19-16-23(27)17-20-33)21-18-31-29(35)32-26-14-8-3-9-15-26;3-2(4,5)1(6)7/h1-2,4-7,10-13,23,26-27,36H,3,8-9,14-22H2,(H-,31,32,35);(H,6,7)/t23?,27-,33?;/m0./s1 |
| InChIKey | ILBCVAATKBSBKZ-ZFUWMPTASA-N |
| XLogP | 3.01 |
| TPSA | 127.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.68 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|