C30H39N2O4+ — CID 87422292
[(3R)-1-[2-(cyclohexylmethylamino)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-diphenylacetate (PubChem CID 87422292) has the molecular formula C30H39N2O4+ and a molecular weight of 491.65 g/mol. Its IUPAC name is [(3R)-1-[2-(cyclohexylmethylamino)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-diphenylacetate.
| Compound Name | [(3R)-1-[2-(cyclohexylmethylamino)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-diphenylacetate |
|---|---|
| PubChem CID | 87422292 |
| Molecular Formula | C30H39N2O4+ |
| Molecular Weight | 491.65 g/mol |
| Exact Mass | 491.29 |
| IUPAC Name | [(3R)-1-[2-(cyclohexylmethylamino)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-diphenylacetate |
| SMILES | O=C(C[N+]12CCC(CC1)[C@@H](OC(=O)C(O)(c1ccccc1)c1ccccc1)C2)NCC1CCCCC1 |
| InChI | InChI=1S/C30H38N2O4/c33-28(31-20-23-10-4-1-5-11-23)22-32-18-16-24(17-19-32)27(21-32)36-29(34)30(35,25-12-6-2-7-13-25)26-14-8-3-9-15-26/h2-3,6-9,12-15,23-24,27,35H,1,4-5,10-11,16-22H2/p+1/t24?,27-,32?/m0/s1 |
| InChIKey | GPPLPOAWZCKMNE-KRXIBUGQSA-O |
| XLogP | 3.77 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.65 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|