C35H36N2O4 — CID 11203630
2-[[1-[3-(naphthalene-2-carbonylamino)propyl]-1-azoniabicyclo[2.2.2]octan-3-yl]oxy]-2-oxo-1,1-diphenylethanolate (PubChem CID 11203630) has the molecular formula C35H36N2O4 and a molecular weight of 548.68 g/mol. Its IUPAC name is 2-[[1-[3-(naphthalene-2-carbonylamino)propyl]-1-azoniabicyclo[2.2.2]octan-3-yl]oxy]-2-oxo-1,1-diphenylethanolate.
| Compound Name | 2-[[1-[3-(naphthalene-2-carbonylamino)propyl]-1-azoniabicyclo[2.2.2]octan-3-yl]oxy]-2-oxo-1,1-diphenylethanolate |
|---|---|
| PubChem CID | 11203630 |
| Molecular Formula | C35H36N2O4 |
| Molecular Weight | 548.68 g/mol |
| Exact Mass | 548.27 |
| IUPAC Name | 2-[[1-[3-(naphthalene-2-carbonylamino)propyl]-1-azoniabicyclo[2.2.2]octan-3-yl]oxy]-2-oxo-1,1-diphenylethanolate |
| SMILES | O=C(NCCC[N+]12CCC(CC1)C(OC(=O)C([O-])(c1ccccc1)c1ccccc1)C2)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C35H36N2O4/c38-33(29-17-16-26-10-7-8-11-28(26)24-29)36-20-9-21-37-22-18-27(19-23-37)32(25-37)41-34(39)35(40,30-12-3-1-4-13-30)31-14-5-2-6-15-31/h1-8,10-17,24,27,32H,9,18-23,25H2,(H,36,38) |
| InChIKey | SZVIHJPUIBONTO-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.68 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|