C31H40N2O4 — CID 11272085
2-[[1-[3-[(2-cyclopentylacetyl)amino]propyl]-1-azoniabicyclo[2.2.2]octan-3-yl]oxy]-2-oxo-1,1-diphenylethanolate (PubChem CID 11272085) has the molecular formula C31H40N2O4 and a molecular weight of 504.67 g/mol. Its IUPAC name is 2-[[1-[3-[(2-cyclopentylacetyl)amino]propyl]-1-azoniabicyclo[2.2.2]octan-3-yl]oxy]-2-oxo-1,1-diphenylethanolate.
| Compound Name | 2-[[1-[3-[(2-cyclopentylacetyl)amino]propyl]-1-azoniabicyclo[2.2.2]octan-3-yl]oxy]-2-oxo-1,1-diphenylethanolate |
|---|---|
| PubChem CID | 11272085 |
| Molecular Formula | C31H40N2O4 |
| Molecular Weight | 504.67 g/mol |
| Exact Mass | 504.30 |
| IUPAC Name | 2-[[1-[3-[(2-cyclopentylacetyl)amino]propyl]-1-azoniabicyclo[2.2.2]octan-3-yl]oxy]-2-oxo-1,1-diphenylethanolate |
| SMILES | O=C(CC1CCCC1)NCCC[N+]12CCC(CC1)C(OC(=O)C([O-])(c1ccccc1)c1ccccc1)C2 |
| InChI | InChI=1S/C31H40N2O4/c34-29(22-24-10-7-8-11-24)32-18-9-19-33-20-16-25(17-21-33)28(23-33)37-30(35)31(36,26-12-3-1-4-13-26)27-14-5-2-6-15-27/h1-6,12-15,24-25,28H,7-11,16-23H2,(H,32,34) |
| InChIKey | IDUJVJVZQUYGDG-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.67 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|