C26H29NO3 — CID 11223405
2-oxo-2-[(1-pent-4-ynyl-1-azoniabicyclo[2.2.2]octan-3-yl)oxy]-1,1-diphenylethanolate (PubChem CID 11223405) has the molecular formula C26H29NO3 and a molecular weight of 403.52 g/mol. Its IUPAC name is 2-oxo-2-[(1-pent-4-ynyl-1-azoniabicyclo[2.2.2]octan-3-yl)oxy]-1,1-diphenylethanolate.
| Compound Name | 2-oxo-2-[(1-pent-4-ynyl-1-azoniabicyclo[2.2.2]octan-3-yl)oxy]-1,1-diphenylethanolate |
|---|---|
| PubChem CID | 11223405 |
| Molecular Formula | C26H29NO3 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | 2-oxo-2-[(1-pent-4-ynyl-1-azoniabicyclo[2.2.2]octan-3-yl)oxy]-1,1-diphenylethanolate |
| SMILES | C#CCCC[N+]12CCC(CC1)C(OC(=O)C([O-])(c1ccccc1)c1ccccc1)C2 |
| InChI | InChI=1S/C26H29NO3/c1-2-3-10-17-27-18-15-21(16-19-27)24(20-27)30-25(28)26(29,22-11-6-4-7-12-22)23-13-8-5-9-14-23/h1,4-9,11-14,21,24H,3,10,15-20H2 |
| InChIKey | CCRDUTGVAUTPLN-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|