C27H35N4O4+ — CID 87437826
[1-[2-oxo-2-(pyrimidin-5-ylamino)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] (2R)-2-cyclohexyl-2-hydroxy-2-phenylacetate (PubChem CID 87437826) has the molecular formula C27H35N4O4+ and a molecular weight of 479.60 g/mol. Its IUPAC name is [1-[2-oxo-2-(pyrimidin-5-ylamino)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] (2R)-2-cyclohexyl-2-hydroxy-2-phenylacetate.
| Compound Name | [1-[2-oxo-2-(pyrimidin-5-ylamino)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] (2R)-2-cyclohexyl-2-hydroxy-2-phenylacetate |
|---|---|
| PubChem CID | 87437826 |
| Molecular Formula | C27H35N4O4+ |
| Molecular Weight | 479.60 g/mol |
| Exact Mass | 479.27 |
| IUPAC Name | [1-[2-oxo-2-(pyrimidin-5-ylamino)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] (2R)-2-cyclohexyl-2-hydroxy-2-phenylacetate |
| SMILES | O=C(C[N+]12CCC(CC1)C(OC(=O)[C@](O)(c1ccccc1)C1CCCCC1)C2)Nc1cncnc1 |
| InChI | InChI=1S/C27H34N4O4/c32-25(30-23-15-28-19-29-16-23)18-31-13-11-20(12-14-31)24(17-31)35-26(33)27(34,21-7-3-1-4-8-21)22-9-5-2-6-10-22/h1,3-4,7-8,15-16,19-20,22,24,34H,2,5-6,9-14,17-18H2/p+1/t20?,24?,27-,31?/m0/s1 |
| InChIKey | JACAANRFLABISK-BXFDIROESA-O |
| XLogP | 3.04 |
| TPSA | 101.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.60 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|