C27H27N4O4+ — CID 87437379
[(3R)-1-[2-oxo-2-(pyrimidin-5-ylamino)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 9-hydroxyfluorene-9-carboxylate (PubChem CID 87437379) has the molecular formula C27H27N4O4+ and a molecular weight of 471.54 g/mol. Its IUPAC name is [(3R)-1-[2-oxo-2-(pyrimidin-5-ylamino)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 9-hydroxyfluorene-9-carboxylate.
| Compound Name | [(3R)-1-[2-oxo-2-(pyrimidin-5-ylamino)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 9-hydroxyfluorene-9-carboxylate |
|---|---|
| PubChem CID | 87437379 |
| Molecular Formula | C27H27N4O4+ |
| Molecular Weight | 471.54 g/mol |
| Exact Mass | 471.20 |
| IUPAC Name | [(3R)-1-[2-oxo-2-(pyrimidin-5-ylamino)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 9-hydroxyfluorene-9-carboxylate |
| SMILES | O=C(C[N+]12CCC(CC1)[C@@H](OC(=O)C1(O)c3ccccc3-c3ccccc31)C2)Nc1cncnc1 |
| InChI | InChI=1S/C27H26N4O4/c32-25(30-19-13-28-17-29-14-19)16-31-11-9-18(10-12-31)24(15-31)35-26(33)27(34)22-7-3-1-5-20(22)21-6-2-4-8-23(21)27/h1-8,13-14,17-18,24,34H,9-12,15-16H2/p+1/t18?,24-,31?/m0/s1 |
| InChIKey | PVKJZEFWXZMKPY-MNGALIJQSA-O |
| XLogP | 2.48 |
| TPSA | 101.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.54 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|