C27H27BrN4O4 — CID 11534076
[(3R)-1-[2-oxo-2-(pyrimidin-4-ylamino)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 9-hydroxyfluorene-9-carboxylate bromide (PubChem CID 11534076) has the molecular formula C27H27BrN4O4 and a molecular weight of 551.44 g/mol. Its IUPAC name is [(3R)-1-[2-oxo-2-(pyrimidin-4-ylamino)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 9-hydroxyfluorene-9-carboxylate bromide.
| Compound Name | [(3R)-1-[2-oxo-2-(pyrimidin-4-ylamino)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 9-hydroxyfluorene-9-carboxylate bromide |
|---|---|
| PubChem CID | 11534076 |
| Molecular Formula | C27H27BrN4O4 |
| Molecular Weight | 551.44 g/mol |
| Exact Mass | 550.12 |
| IUPAC Name | [(3R)-1-[2-oxo-2-(pyrimidin-4-ylamino)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 9-hydroxyfluorene-9-carboxylate bromide |
| SMILES | O=C(C[N+]12CCC(CC1)[C@@H](OC(=O)C1(O)c3ccccc3-c3ccccc31)C2)Nc1ccncn1.[Br-] |
| InChI | InChI=1S/C27H26N4O4.BrH/c32-25(30-24-9-12-28-17-29-24)16-31-13-10-18(11-14-31)23(15-31)35-26(33)27(34)21-7-3-1-5-19(21)20-6-2-4-8-22(20)27;/h1-9,12,17-18,23,34H,10-11,13-16H2;1H/t18?,23-,31?;/m0./s1 |
| InChIKey | GBFGPOWJLPODQG-SGFHCSRJSA-N |
| XLogP | -0.51 |
| TPSA | 101.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.44 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|