C25H27N4O4S+ — CID 11642553
[(3R)-1-[2-oxo-2-(pyrimidin-4-ylamino)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2-phenyl-2-thiophen-3-ylacetate (PubChem CID 11642553) has the molecular formula C25H27N4O4S+ and a molecular weight of 479.58 g/mol. Its IUPAC name is [(3R)-1-[2-oxo-2-(pyrimidin-4-ylamino)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2-phenyl-2-thiophen-3-ylacetate.
| Compound Name | [(3R)-1-[2-oxo-2-(pyrimidin-4-ylamino)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2-phenyl-2-thiophen-3-ylacetate |
|---|---|
| PubChem CID | 11642553 |
| Molecular Formula | C25H27N4O4S+ |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | [(3R)-1-[2-oxo-2-(pyrimidin-4-ylamino)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2-phenyl-2-thiophen-3-ylacetate |
| SMILES | O=C(C[N+]12CCC(CC1)[C@@H](OC(=O)C(O)(c1ccccc1)c1ccsc1)C2)Nc1ccncn1 |
| InChI | InChI=1S/C25H26N4O4S/c30-23(28-22-6-10-26-17-27-22)15-29-11-7-18(8-12-29)21(14-29)33-24(31)25(32,20-9-13-34-16-20)19-4-2-1-3-5-19/h1-6,9-10,13,16-18,21,32H,7-8,11-12,14-15H2/p+1/t18?,21-,25?,29?/m0/s1 |
| InChIKey | QCQSWPQCBVUMCJ-OXPZDXOXSA-O |
| XLogP | 2.56 |
| TPSA | 101.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|