C26H28NO3S2+ — CID 66592903
[1-[(E)-3-phenylprop-2-enyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-di(thiophen-3-yl)acetate (PubChem CID 66592903) has the molecular formula C26H28NO3S2+ and a molecular weight of 466.65 g/mol. Its IUPAC name is [1-[(E)-3-phenylprop-2-enyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-di(thiophen-3-yl)acetate.
| Compound Name | [1-[(E)-3-phenylprop-2-enyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-di(thiophen-3-yl)acetate |
|---|---|
| PubChem CID | 66592903 |
| Molecular Formula | C26H28NO3S2+ |
| Molecular Weight | 466.65 g/mol |
| Exact Mass | 466.15 |
| IUPAC Name | [1-[(E)-3-phenylprop-2-enyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-di(thiophen-3-yl)acetate |
| SMILES | O=C(OC1C[N+]2(C/C=C/c3ccccc3)CCC1CC2)C(O)(c1ccsc1)c1ccsc1 |
| InChI | InChI=1S/C26H28NO3S2/c28-25(26(29,22-10-15-31-18-22)23-11-16-32-19-23)30-24-17-27(13-8-21(24)9-14-27)12-4-7-20-5-2-1-3-6-20/h1-7,10-11,15-16,18-19,21,24,29H,8-9,12-14,17H2/q+1/b7-4+ |
| InChIKey | DCOJCPMKTAZMKW-QPJJXVBHSA-N |
| XLogP | 4.91 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.65 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|