C25H31N4O4+ — CID 67539857
[1-(pyridazin-3-ylcarbamoyl)-1-azoniabicyclo[2.2.2]octan-3-yl] (2R)-2-cyclopentyl-2-hydroxy-2-phenylacetate (PubChem CID 67539857) has the molecular formula C25H31N4O4+ and a molecular weight of 451.55 g/mol. Its IUPAC name is [1-(pyridazin-3-ylcarbamoyl)-1-azoniabicyclo[2.2.2]octan-3-yl] (2R)-2-cyclopentyl-2-hydroxy-2-phenylacetate.
| Compound Name | [1-(pyridazin-3-ylcarbamoyl)-1-azoniabicyclo[2.2.2]octan-3-yl] (2R)-2-cyclopentyl-2-hydroxy-2-phenylacetate |
|---|---|
| PubChem CID | 67539857 |
| Molecular Formula | C25H31N4O4+ |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 451.23 |
| IUPAC Name | [1-(pyridazin-3-ylcarbamoyl)-1-azoniabicyclo[2.2.2]octan-3-yl] (2R)-2-cyclopentyl-2-hydroxy-2-phenylacetate |
| SMILES | O=C(OC1C[N+]2(C(=O)Nc3cccnn3)CCC1CC2)[C@](O)(c1ccccc1)C1CCCC1 |
| InChI | InChI=1S/C25H30N4O4/c30-23(25(32,20-9-4-5-10-20)19-7-2-1-3-8-19)33-21-17-29(15-12-18(21)13-16-29)24(31)27-22-11-6-14-26-28-22/h1-3,6-8,11,14,18,20-21,32H,4-5,9-10,12-13,15-17H2/p+1/t18?,21?,25-,29?/m0/s1 |
| InChIKey | JANDIKWZCAIHKJ-UVYQYPNLSA-O |
| XLogP | 3.24 |
| TPSA | 101.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|