C23H29BrN4O4S — CID 67539930
[(3R)-1-(pyridazin-3-ylcarbamoyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 2-cyclopentyl-2-hydroxy-2-thiophen-2-ylacetate bromide (PubChem CID 67539930) has the molecular formula C23H29BrN4O4S and a molecular weight of 537.48 g/mol. Its IUPAC name is [(3R)-1-(pyridazin-3-ylcarbamoyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 2-cyclopentyl-2-hydroxy-2-thiophen-2-ylacetate bromide.
| Compound Name | [(3R)-1-(pyridazin-3-ylcarbamoyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 2-cyclopentyl-2-hydroxy-2-thiophen-2-ylacetate bromide |
|---|---|
| PubChem CID | 67539930 |
| Molecular Formula | C23H29BrN4O4S |
| Molecular Weight | 537.48 g/mol |
| Exact Mass | 536.11 |
| IUPAC Name | [(3R)-1-(pyridazin-3-ylcarbamoyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 2-cyclopentyl-2-hydroxy-2-thiophen-2-ylacetate bromide |
| SMILES | O=C(O[C@H]1C[N+]2(C(=O)Nc3cccnn3)CCC1CC2)C(O)(c1cccs1)C1CCCC1.[Br-] |
| InChI | InChI=1S/C23H28N4O4S.BrH/c28-21(23(30,17-5-1-2-6-17)19-7-4-14-32-19)31-18-15-27(12-9-16(18)10-13-27)22(29)25-20-8-3-11-24-26-20;/h3-4,7-8,11,14,16-18,30H,1-2,5-6,9-10,12-13,15H2;1H/t16?,18-,23?,27?;/m0./s1 |
| InChIKey | DZCKMHXNWKSWTB-PKPSOOLGSA-N |
| XLogP | 0.30 |
| TPSA | 101.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.48 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|