C24H31N4O5+ — CID 67538676
[(3R)-1-(pyridazin-3-ylcarbamoyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 2-cyclohexyl-2-(furan-2-yl)-2-hydroxyacetate (PubChem CID 67538676) has the molecular formula C24H31N4O5+ and a molecular weight of 455.54 g/mol. Its IUPAC name is [(3R)-1-(pyridazin-3-ylcarbamoyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 2-cyclohexyl-2-(furan-2-yl)-2-hydroxyacetate.
| Compound Name | [(3R)-1-(pyridazin-3-ylcarbamoyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 2-cyclohexyl-2-(furan-2-yl)-2-hydroxyacetate |
|---|---|
| PubChem CID | 67538676 |
| Molecular Formula | C24H31N4O5+ |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.23 |
| IUPAC Name | [(3R)-1-(pyridazin-3-ylcarbamoyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 2-cyclohexyl-2-(furan-2-yl)-2-hydroxyacetate |
| SMILES | O=C(O[C@H]1C[N+]2(C(=O)Nc3cccnn3)CCC1CC2)C(O)(c1ccco1)C1CCCCC1 |
| InChI | InChI=1S/C24H30N4O5/c29-22(24(31,20-8-5-15-32-20)18-6-2-1-3-7-18)33-19-16-28(13-10-17(19)11-14-28)23(30)26-21-9-4-12-25-27-21/h4-5,8-9,12,15,17-19,31H,1-3,6-7,10-11,13-14,16H2/p+1/t17?,19-,24?,28?/m0/s1 |
| InChIKey | WHXWDAVEWDGCLH-QDBCHFMASA-O |
| XLogP | 3.22 |
| TPSA | 114.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|