C25H33N4O5+ — CID 87456381
[(3R)-1-(2-amino-2-oxo-1-pyrimidin-2-ylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 2-cyclohexyl-2-(furan-2-yl)-2-hydroxyacetate (PubChem CID 87456381) has the molecular formula C25H33N4O5+ and a molecular weight of 469.56 g/mol. Its IUPAC name is [(3R)-1-(2-amino-2-oxo-1-pyrimidin-2-ylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 2-cyclohexyl-2-(furan-2-yl)-2-hydroxyacetate.
| Compound Name | [(3R)-1-(2-amino-2-oxo-1-pyrimidin-2-ylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 2-cyclohexyl-2-(furan-2-yl)-2-hydroxyacetate |
|---|---|
| PubChem CID | 87456381 |
| Molecular Formula | C25H33N4O5+ |
| Molecular Weight | 469.56 g/mol |
| Exact Mass | 469.24 |
| IUPAC Name | [(3R)-1-(2-amino-2-oxo-1-pyrimidin-2-ylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 2-cyclohexyl-2-(furan-2-yl)-2-hydroxyacetate |
| SMILES | NC(=O)C(c1ncccn1)[N+]12CCC(CC1)[C@@H](OC(=O)C(O)(c1ccco1)C1CCCCC1)C2 |
| InChI | InChI=1S/C25H32N4O5/c26-22(30)21(23-27-11-5-12-28-23)29-13-9-17(10-14-29)19(16-29)34-24(31)25(32,20-8-4-15-33-20)18-6-2-1-3-7-18/h4-5,8,11-12,15,17-19,21,32H,1-3,6-7,9-10,13-14,16H2,(H-,26,30)/p+1/t17?,19-,21?,25?,29?/m0/s1 |
| InChIKey | LKDXOYJIXHGHMH-BMRTWKBOSA-O |
| XLogP | 2.22 |
| TPSA | 128.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.56 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|