C22H24N3O7+ — CID 87456846
[(3R)-1-[2-amino-1-(1,2-oxazol-3-yl)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2,2-bis(furan-3-yl)-2-hydroxyacetate (PubChem CID 87456846) has the molecular formula C22H24N3O7+ and a molecular weight of 442.45 g/mol. Its IUPAC name is [(3R)-1-[2-amino-1-(1,2-oxazol-3-yl)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2,2-bis(furan-3-yl)-2-hydroxyacetate.
| Compound Name | [(3R)-1-[2-amino-1-(1,2-oxazol-3-yl)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2,2-bis(furan-3-yl)-2-hydroxyacetate |
|---|---|
| PubChem CID | 87456846 |
| Molecular Formula | C22H24N3O7+ |
| Molecular Weight | 442.45 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | [(3R)-1-[2-amino-1-(1,2-oxazol-3-yl)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2,2-bis(furan-3-yl)-2-hydroxyacetate |
| SMILES | NC(=O)C(c1ccon1)[N+]12CCC(CC1)[C@@H](OC(=O)C(O)(c1ccoc1)c1ccoc1)C2 |
| InChI | InChI=1S/C22H23N3O7/c23-20(26)19(17-5-10-31-24-17)25-6-1-14(2-7-25)18(11-25)32-21(27)22(28,15-3-8-29-12-15)16-4-9-30-13-16/h3-5,8-10,12-14,18-19,28H,1-2,6-7,11H2,(H-,23,26)/p+1/t14?,18-,19?,25?/m0/s1 |
| InChIKey | BABBOTDLEMPBPP-PAIUYBCYSA-O |
| XLogP | 1.48 |
| TPSA | 141.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.45 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|