C26H29N4O4+ — CID 87462684
[(3R)-1-[2-amino-1-(1,2-oxazol-3-yl)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-anilino-2-phenylacetate (PubChem CID 87462684) has the molecular formula C26H29N4O4+ and a molecular weight of 461.54 g/mol. Its IUPAC name is [(3R)-1-[2-amino-1-(1,2-oxazol-3-yl)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-anilino-2-phenylacetate.
| Compound Name | [(3R)-1-[2-amino-1-(1,2-oxazol-3-yl)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-anilino-2-phenylacetate |
|---|---|
| PubChem CID | 87462684 |
| Molecular Formula | C26H29N4O4+ |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 461.22 |
| IUPAC Name | [(3R)-1-[2-amino-1-(1,2-oxazol-3-yl)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-anilino-2-phenylacetate |
| SMILES | NC(=O)C(c1ccon1)[N+]12CCC(CC1)[C@@H](OC(=O)C(Nc1ccccc1)c1ccccc1)C2 |
| InChI | InChI=1S/C26H28N4O4/c27-25(31)24(21-13-16-33-29-21)30-14-11-18(12-15-30)22(17-30)34-26(32)23(19-7-3-1-4-8-19)28-20-9-5-2-6-10-20/h1-10,13,16,18,22-24,28H,11-12,14-15,17H2,(H-,27,31)/p+1/t18?,22-,23?,24?,30?/m0/s1 |
| InChIKey | QGMGSADEROTXAS-WRVNPNLNSA-O |
| XLogP | 3.21 |
| TPSA | 107.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|