C25H32N3O3+ — CID 46841968
[(3R)-1-[2-(dimethylamino)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] (2R)-2-anilino-2-phenylacetate (PubChem CID 46841968) has the molecular formula C25H32N3O3+ and a molecular weight of 422.55 g/mol. Its IUPAC name is [(3R)-1-[2-(dimethylamino)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] (2R)-2-anilino-2-phenylacetate.
| Compound Name | [(3R)-1-[2-(dimethylamino)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] (2R)-2-anilino-2-phenylacetate |
|---|---|
| PubChem CID | 46841968 |
| Molecular Formula | C25H32N3O3+ |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.24 |
| IUPAC Name | [(3R)-1-[2-(dimethylamino)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] (2R)-2-anilino-2-phenylacetate |
| SMILES | CN(C)C(=O)C[N+]12CCC(CC1)[C@@H](OC(=O)[C@H](Nc1ccccc1)c1ccccc1)C2 |
| InChI | InChI=1S/C25H32N3O3/c1-27(2)23(29)18-28-15-13-19(14-16-28)22(17-28)31-25(30)24(20-9-5-3-6-10-20)26-21-11-7-4-8-12-21/h3-12,19,22,24,26H,13-18H2,1-2H3/q+1/t19?,22-,24+,28?/m0/s1 |
| InChIKey | VXFXOJZJJIGJKJ-YGFZSLBQSA-N |
| XLogP | 3.08 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|