C31H35N2O4+ — CID 88875397
[(3R)-1-[2-(4-ethoxyphenyl)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-anilino-2-phenylacetate (PubChem CID 88875397) has the molecular formula C31H35N2O4+ and a molecular weight of 499.63 g/mol. Its IUPAC name is [(3R)-1-[2-(4-ethoxyphenyl)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-anilino-2-phenylacetate.
| Compound Name | [(3R)-1-[2-(4-ethoxyphenyl)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-anilino-2-phenylacetate |
|---|---|
| PubChem CID | 88875397 |
| Molecular Formula | C31H35N2O4+ |
| Molecular Weight | 499.63 g/mol |
| Exact Mass | 499.26 |
| IUPAC Name | [(3R)-1-[2-(4-ethoxyphenyl)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-anilino-2-phenylacetate |
| SMILES | CCOc1ccc(C(=O)C[N+]23CCC(CC2)[C@@H](OC(=O)C(Nc2ccccc2)c2ccccc2)C3)cc1 |
| InChI | InChI=1S/C31H35N2O4/c1-2-36-27-15-13-23(14-16-27)28(34)21-33-19-17-24(18-20-33)29(22-33)37-31(35)30(25-9-5-3-6-10-25)32-26-11-7-4-8-12-26/h3-16,24,29-30,32H,2,17-22H2,1H3/q+1/t24?,29-,30?,33?/m0/s1 |
| InChIKey | CVPAVBAZRVKGAN-GYQVGWFTSA-N |
| XLogP | 5.27 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.63 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|