C34H40N3O4+ — CID 54771305
[(3R)-1-[2-[4-(3-acetamidopropyl)phenyl]-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] (2R)-2-anilino-2-phenylacetate (PubChem CID 54771305) has the molecular formula C34H40N3O4+ and a molecular weight of 554.71 g/mol. Its IUPAC name is [(3R)-1-[2-[4-(3-acetamidopropyl)phenyl]-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] (2R)-2-anilino-2-phenylacetate.
| Compound Name | [(3R)-1-[2-[4-(3-acetamidopropyl)phenyl]-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] (2R)-2-anilino-2-phenylacetate |
|---|---|
| PubChem CID | 54771305 |
| Molecular Formula | C34H40N3O4+ |
| Molecular Weight | 554.71 g/mol |
| Exact Mass | 554.30 |
| IUPAC Name | [(3R)-1-[2-[4-(3-acetamidopropyl)phenyl]-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] (2R)-2-anilino-2-phenylacetate |
| SMILES | CC(=O)NCCCc1ccc(C(=O)C[N+]23CCC(CC2)[C@@H](OC(=O)[C@H](Nc2ccccc2)c2ccccc2)C3)cc1 |
| InChI | InChI=1S/C34H39N3O4/c1-25(38)35-20-8-9-26-14-16-27(17-15-26)31(39)23-37-21-18-28(19-22-37)32(24-37)41-34(40)33(29-10-4-2-5-11-29)36-30-12-6-3-7-13-30/h2-7,10-17,28,32-33,36H,8-9,18-24H2,1H3/p+1/t28?,32-,33+,37?/m0/s1 |
| InChIKey | NIMFNPHDPUSMHK-XTPGCGCFSA-O |
| XLogP | 4.94 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.71 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|