C29H30BrFN2O3 — CID 87394408
[(3R)-1-[2-(3-fluorophenyl)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-anilino-2-phenylacetate bromide (PubChem CID 87394408) has the molecular formula C29H30BrFN2O3 and a molecular weight of 553.47 g/mol. Its IUPAC name is [(3R)-1-[2-(3-fluorophenyl)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-anilino-2-phenylacetate bromide.
| Compound Name | [(3R)-1-[2-(3-fluorophenyl)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-anilino-2-phenylacetate bromide |
|---|---|
| PubChem CID | 87394408 |
| Molecular Formula | C29H30BrFN2O3 |
| Molecular Weight | 553.47 g/mol |
| Exact Mass | 552.14 |
| IUPAC Name | [(3R)-1-[2-(3-fluorophenyl)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-anilino-2-phenylacetate bromide |
| SMILES | O=C(C[N+]12CCC(CC1)[C@@H](OC(=O)C(Nc1ccccc1)c1ccccc1)C2)c1cccc(F)c1.[Br-] |
| InChI | InChI=1S/C29H30FN2O3.BrH/c30-24-11-7-10-23(18-24)26(33)19-32-16-14-21(15-17-32)27(20-32)35-29(34)28(22-8-3-1-4-9-22)31-25-12-5-2-6-13-25;/h1-13,18,21,27-28,31H,14-17,19-20H2;1H/q+1;/p-1/t21?,27-,28?,32?;/m0./s1 |
| InChIKey | JDHGJRRQOPBVCU-TWQZTKIZSA-M |
| XLogP | 2.02 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.47 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|