C31H32BrN3O4 — CID 46842408
[(3R)-1-[2-oxo-2-(2-oxo-1,3-dihydroindol-5-yl)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-anilino-2-phenylacetate bromide (PubChem CID 46842408) has the molecular formula C31H32BrN3O4 and a molecular weight of 590.52 g/mol. Its IUPAC name is [(3R)-1-[2-oxo-2-(2-oxo-1,3-dihydroindol-5-yl)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-anilino-2-phenylacetate bromide.
| Compound Name | [(3R)-1-[2-oxo-2-(2-oxo-1,3-dihydroindol-5-yl)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-anilino-2-phenylacetate bromide |
|---|---|
| PubChem CID | 46842408 |
| Molecular Formula | C31H32BrN3O4 |
| Molecular Weight | 590.52 g/mol |
| Exact Mass | 589.16 |
| IUPAC Name | [(3R)-1-[2-oxo-2-(2-oxo-1,3-dihydroindol-5-yl)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-anilino-2-phenylacetate bromide |
| SMILES | O=C1Cc2cc(C(=O)C[N+]34CCC(CC3)[C@@H](OC(=O)C(Nc3ccccc3)c3ccccc3)C4)ccc2N1.[Br-] |
| InChI | InChI=1S/C31H31N3O4.BrH/c35-27(23-11-12-26-24(17-23)18-29(36)33-26)19-34-15-13-21(14-16-34)28(20-34)38-31(37)30(22-7-3-1-4-8-22)32-25-9-5-2-6-10-25;/h1-12,17,21,28,30,32H,13-16,18-20H2;1H/t21?,28-,30?,34?;/m0./s1 |
| InChIKey | VOJCDVAKSMUITF-HPEWGJSUSA-N |
| XLogP | 1.37 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.52 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|