C29H31ClN2O3 — CID 86691136
[(3R)-1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl] (2R)-2-anilino-2-phenylacetate chloride (PubChem CID 86691136) has the molecular formula C29H31ClN2O3 and a molecular weight of 491.03 g/mol. Its IUPAC name is [(3R)-1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl] (2R)-2-anilino-2-phenylacetate chloride.
| Compound Name | [(3R)-1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl] (2R)-2-anilino-2-phenylacetate chloride |
|---|---|
| PubChem CID | 86691136 |
| Molecular Formula | C29H31ClN2O3 |
| Molecular Weight | 491.03 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | [(3R)-1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl] (2R)-2-anilino-2-phenylacetate chloride |
| SMILES | O=C(C[N+]12CCC(CC1)[C@@H](OC(=O)[C@H](Nc1ccccc1)c1ccccc1)C2)c1ccccc1.[Cl-] |
| InChI | InChI=1S/C29H31N2O3.ClH/c32-26(22-10-4-1-5-11-22)20-31-18-16-23(17-19-31)27(21-31)34-29(33)28(24-12-6-2-7-13-24)30-25-14-8-3-9-15-25;/h1-15,23,27-28,30H,16-21H2;1H/q+1;/p-1/t23?,27-,28+,31?;/m0./s1 |
| InChIKey | DFVVUOVIURCEAA-RNYAXRKGSA-M |
| XLogP | 1.88 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.03 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|