C30H33Cl2N2O3+ — CID 161488893
[(3R)-1-[2-(3,4-dichlorophenyl)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-anilino-2-phenylacetate;methane (PubChem CID 161488893) has the molecular formula C30H33Cl2N2O3+ and a molecular weight of 540.51 g/mol. Its IUPAC name is [(3R)-1-[2-(3,4-dichlorophenyl)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-anilino-2-phenylacetate;methane.
| Compound Name | [(3R)-1-[2-(3,4-dichlorophenyl)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-anilino-2-phenylacetate;methane |
|---|---|
| PubChem CID | 161488893 |
| Molecular Formula | C30H33Cl2N2O3+ |
| Molecular Weight | 540.51 g/mol |
| Exact Mass | 539.19 |
| IUPAC Name | [(3R)-1-[2-(3,4-dichlorophenyl)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-anilino-2-phenylacetate;methane |
| SMILES | C.O=C(C[N+]12CCC(CC1)[C@@H](OC(=O)C(Nc1ccccc1)c1ccccc1)C2)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C29H29Cl2N2O3.CH4/c30-24-12-11-22(17-25(24)31)26(34)18-33-15-13-20(14-16-33)27(19-33)36-29(35)28(21-7-3-1-4-8-21)32-23-9-5-2-6-10-23;/h1-12,17,20,27-28,32H,13-16,18-19H2;1H4/q+1;/t20?,27-,28?,33?;/m0./s1 |
| InChIKey | WFIOEMQRFKDBCG-HMHNAJNESA-N |
| XLogP | 6.82 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.51 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|