C30H32N3O5+ — CID 88875283
[(3R)-1-[2-(3-carbamoyl-4-hydroxyphenyl)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-anilino-2-phenylacetate (PubChem CID 88875283) has the molecular formula C30H32N3O5+ and a molecular weight of 514.60 g/mol. Its IUPAC name is [(3R)-1-[2-(3-carbamoyl-4-hydroxyphenyl)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-anilino-2-phenylacetate.
| Compound Name | [(3R)-1-[2-(3-carbamoyl-4-hydroxyphenyl)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-anilino-2-phenylacetate |
|---|---|
| PubChem CID | 88875283 |
| Molecular Formula | C30H32N3O5+ |
| Molecular Weight | 514.60 g/mol |
| Exact Mass | 514.23 |
| IUPAC Name | [(3R)-1-[2-(3-carbamoyl-4-hydroxyphenyl)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-anilino-2-phenylacetate |
| SMILES | NC(=O)c1cc(C(=O)C[N+]23CCC(CC2)[C@@H](OC(=O)C(Nc2ccccc2)c2ccccc2)C3)ccc1O |
| InChI | InChI=1S/C30H31N3O5/c31-29(36)24-17-22(11-12-25(24)34)26(35)18-33-15-13-20(14-16-33)27(19-33)38-30(37)28(21-7-3-1-4-8-21)32-23-9-5-2-6-10-23/h1-12,17,20,27-28,32H,13-16,18-19H2,(H2-,31,34,35,36)/p+1/t20?,27-,28?,33?/m0/s1 |
| InChIKey | KLMCPYGJTFBUAY-PVVDUQOGSA-O |
| XLogP | 3.68 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.60 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|