C30H33N2O3+ — CID 87573511
[(3R)-1-[2-(4-methylphenyl)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-anilino-2-phenylacetate (PubChem CID 87573511) has the molecular formula C30H33N2O3+ and a molecular weight of 469.61 g/mol. Its IUPAC name is [(3R)-1-[2-(4-methylphenyl)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-anilino-2-phenylacetate.
| Compound Name | [(3R)-1-[2-(4-methylphenyl)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-anilino-2-phenylacetate |
|---|---|
| PubChem CID | 87573511 |
| Molecular Formula | C30H33N2O3+ |
| Molecular Weight | 469.61 g/mol |
| Exact Mass | 469.25 |
| IUPAC Name | [(3R)-1-[2-(4-methylphenyl)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-anilino-2-phenylacetate |
| SMILES | Cc1ccc(C(=O)C[N+]23CCC(CC2)[C@@H](OC(=O)C(Nc2ccccc2)c2ccccc2)C3)cc1 |
| InChI | InChI=1S/C30H33N2O3/c1-22-12-14-23(15-13-22)27(33)20-32-18-16-24(17-19-32)28(21-32)35-30(34)29(25-8-4-2-5-9-25)31-26-10-6-3-7-11-26/h2-15,24,28-29,31H,16-21H2,1H3/q+1/t24?,28-,29?,32?/m0/s1 |
| InChIKey | YQNFPARFJRXBPB-NFUAJFPJSA-N |
| XLogP | 5.18 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.61 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|