C32H35N2O5+ — CID 59401170
ethyl 3-[[2-oxo-2-[[(3R)-1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl]oxy]-1-phenylethyl]amino]benzoate (PubChem CID 59401170) has the molecular formula C32H35N2O5+ and a molecular weight of 527.64 g/mol. Its IUPAC name is ethyl 3-[[2-oxo-2-[[(3R)-1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl]oxy]-1-phenylethyl]amino]benzoate.
| Compound Name | ethyl 3-[[2-oxo-2-[[(3R)-1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl]oxy]-1-phenylethyl]amino]benzoate |
|---|---|
| PubChem CID | 59401170 |
| Molecular Formula | C32H35N2O5+ |
| Molecular Weight | 527.64 g/mol |
| Exact Mass | 527.25 |
| IUPAC Name | ethyl 3-[[2-oxo-2-[[(3R)-1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl]oxy]-1-phenylethyl]amino]benzoate |
| SMILES | CCOC(=O)c1cccc(NC(C(=O)O[C@H]2C[N+]3(CC(=O)c4ccccc4)CCC2CC3)c2ccccc2)c1 |
| InChI | InChI=1S/C32H35N2O5/c1-2-38-31(36)26-14-9-15-27(20-26)33-30(25-12-7-4-8-13-25)32(37)39-29-22-34(18-16-24(29)17-19-34)21-28(35)23-10-5-3-6-11-23/h3-15,20,24,29-30,33H,2,16-19,21-22H2,1H3/q+1/t24?,29-,30?,34?/m0/s1 |
| InChIKey | LSMYMBMVGJEJLQ-PCOPRYJHSA-N |
| XLogP | 5.05 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.64 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|