C34H39N2O5+ — CID 76828738
butyl 4-[2-[3-(2-anilino-2-phenylacetyl)oxy-1-azoniabicyclo[2.2.2]octan-1-yl]acetyl]benzoate (PubChem CID 76828738) has the molecular formula C34H39N2O5+ and a molecular weight of 555.69 g/mol. Its IUPAC name is butyl 4-[2-[3-(2-anilino-2-phenylacetyl)oxy-1-azoniabicyclo[2.2.2]octan-1-yl]acetyl]benzoate.
| Compound Name | butyl 4-[2-[3-(2-anilino-2-phenylacetyl)oxy-1-azoniabicyclo[2.2.2]octan-1-yl]acetyl]benzoate |
|---|---|
| PubChem CID | 76828738 |
| Molecular Formula | C34H39N2O5+ |
| Molecular Weight | 555.69 g/mol |
| Exact Mass | 555.29 |
| IUPAC Name | butyl 4-[2-[3-(2-anilino-2-phenylacetyl)oxy-1-azoniabicyclo[2.2.2]octan-1-yl]acetyl]benzoate |
| SMILES | CCCCOC(=O)c1ccc(C(=O)C[N+]23CCC(CC2)C(OC(=O)C(Nc2ccccc2)c2ccccc2)C3)cc1 |
| InChI | InChI=1S/C34H39N2O5/c1-2-3-22-40-33(38)28-16-14-25(15-17-28)30(37)23-36-20-18-26(19-21-36)31(24-36)41-34(39)32(27-10-6-4-7-11-27)35-29-12-8-5-9-13-29/h4-17,26,31-32,35H,2-3,18-24H2,1H3/q+1 |
| InChIKey | CZCBPHVNIVVCFQ-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.69 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|