C28H31N2O3S+ — CID 87395537
[(3R)-1-[2-(5-methylthiophen-3-yl)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-anilino-2-phenylacetate (PubChem CID 87395537) has the molecular formula C28H31N2O3S+ and a molecular weight of 475.63 g/mol. Its IUPAC name is [(3R)-1-[2-(5-methylthiophen-3-yl)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-anilino-2-phenylacetate.
| Compound Name | [(3R)-1-[2-(5-methylthiophen-3-yl)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-anilino-2-phenylacetate |
|---|---|
| PubChem CID | 87395537 |
| Molecular Formula | C28H31N2O3S+ |
| Molecular Weight | 475.63 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | [(3R)-1-[2-(5-methylthiophen-3-yl)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-anilino-2-phenylacetate |
| SMILES | Cc1cc(C(=O)C[N+]23CCC(CC2)[C@@H](OC(=O)C(Nc2ccccc2)c2ccccc2)C3)cs1 |
| InChI | InChI=1S/C28H31N2O3S/c1-20-16-23(19-34-20)25(31)17-30-14-12-21(13-15-30)26(18-30)33-28(32)27(22-8-4-2-5-9-22)29-24-10-6-3-7-11-24/h2-11,16,19,21,26-27,29H,12-15,17-18H2,1H3/q+1/t21?,26-,27?,30?/m0/s1 |
| InChIKey | WWHQQIDIDUJHSB-WADAJPNISA-N |
| XLogP | 5.24 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.63 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|