C30H31N2O5+ — CID 59401142
[(3R)-1-[2-(1,3-benzodioxol-5-yl)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] (2R)-2-anilino-2-phenylacetate (PubChem CID 59401142) has the molecular formula C30H31N2O5+ and a molecular weight of 499.59 g/mol. Its IUPAC name is [(3R)-1-[2-(1,3-benzodioxol-5-yl)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] (2R)-2-anilino-2-phenylacetate.
| Compound Name | [(3R)-1-[2-(1,3-benzodioxol-5-yl)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] (2R)-2-anilino-2-phenylacetate |
|---|---|
| PubChem CID | 59401142 |
| Molecular Formula | C30H31N2O5+ |
| Molecular Weight | 499.59 g/mol |
| Exact Mass | 499.22 |
| IUPAC Name | [(3R)-1-[2-(1,3-benzodioxol-5-yl)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] (2R)-2-anilino-2-phenylacetate |
| SMILES | O=C(C[N+]12CCC(CC1)[C@@H](OC(=O)[C@H](Nc1ccccc1)c1ccccc1)C2)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C30H31N2O5/c33-25(23-11-12-26-27(17-23)36-20-35-26)18-32-15-13-21(14-16-32)28(19-32)37-30(34)29(22-7-3-1-4-8-22)31-24-9-5-2-6-10-24/h1-12,17,21,28-29,31H,13-16,18-20H2/q+1/t21?,28-,29+,32?/m0/s1 |
| InChIKey | DGNFMYVTTZZHMV-QMJCVLJGSA-N |
| XLogP | 4.60 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.59 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|