C29H30FN2O3+ — CID 59401179
[(3R)-1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl] 2-(2-fluoroanilino)-2-phenylacetate (PubChem CID 59401179) has the molecular formula C29H30FN2O3+ and a molecular weight of 473.57 g/mol. Its IUPAC name is [(3R)-1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl] 2-(2-fluoroanilino)-2-phenylacetate.
| Compound Name | [(3R)-1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl] 2-(2-fluoroanilino)-2-phenylacetate |
|---|---|
| PubChem CID | 59401179 |
| Molecular Formula | C29H30FN2O3+ |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.22 |
| IUPAC Name | [(3R)-1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl] 2-(2-fluoroanilino)-2-phenylacetate |
| SMILES | O=C(C[N+]12CCC(CC1)[C@@H](OC(=O)C(Nc1ccccc1F)c1ccccc1)C2)c1ccccc1 |
| InChI | InChI=1S/C29H30FN2O3/c30-24-13-7-8-14-25(24)31-28(23-11-5-2-6-12-23)29(34)35-27-20-32(17-15-22(27)16-18-32)19-26(33)21-9-3-1-4-10-21/h1-14,22,27-28,31H,15-20H2/q+1/t22?,27-,28?,32?/m0/s1 |
| InChIKey | VPXIZVMMXKLMEM-RVPUKUGYSA-N |
| XLogP | 5.01 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|