C31H33N2O5+ — CID 86665825
[(3R)-1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl] 2-phenyl-2-(phenylmethoxycarbonylamino)acetate (PubChem CID 86665825) has the molecular formula C31H33N2O5+ and a molecular weight of 513.61 g/mol. Its IUPAC name is [(3R)-1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl] 2-phenyl-2-(phenylmethoxycarbonylamino)acetate.
| Compound Name | [(3R)-1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl] 2-phenyl-2-(phenylmethoxycarbonylamino)acetate |
|---|---|
| PubChem CID | 86665825 |
| Molecular Formula | C31H33N2O5+ |
| Molecular Weight | 513.61 g/mol |
| Exact Mass | 513.24 |
| IUPAC Name | [(3R)-1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl] 2-phenyl-2-(phenylmethoxycarbonylamino)acetate |
| SMILES | O=C(NC(C(=O)O[C@H]1C[N+]2(CC(=O)c3ccccc3)CCC1CC2)c1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C31H32N2O5/c34-27(24-12-6-2-7-13-24)20-33-18-16-25(17-19-33)28(21-33)38-30(35)29(26-14-8-3-9-15-26)32-31(36)37-22-23-10-4-1-5-11-23/h1-15,25,28-29H,16-22H2/p+1/t25?,28-,29?,33?/m0/s1 |
| InChIKey | XAYNIYQJOZXBNF-PCNRPYBXSA-O |
| XLogP | 4.69 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.61 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|