C30H30ClN2O4+ — CID 123527378
(1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl) 2-benzamido-2-(4-chlorophenyl)acetate (PubChem CID 123527378) has the molecular formula C30H30ClN2O4+ and a molecular weight of 518.03 g/mol. Its IUPAC name is (1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl) 2-benzamido-2-(4-chlorophenyl)acetate.
| Compound Name | (1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl) 2-benzamido-2-(4-chlorophenyl)acetate |
|---|---|
| PubChem CID | 123527378 |
| Molecular Formula | C30H30ClN2O4+ |
| Molecular Weight | 518.03 g/mol |
| Exact Mass | 517.19 |
| IUPAC Name | (1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl) 2-benzamido-2-(4-chlorophenyl)acetate |
| SMILES | O=C(C[N+]12CCC(CC1)C(OC(=O)C(NC(=O)c1ccccc1)c1ccc(Cl)cc1)C2)c1ccccc1 |
| InChI | InChI=1S/C30H29ClN2O4/c31-25-13-11-23(12-14-25)28(32-29(35)24-9-5-2-6-10-24)30(36)37-27-20-33(17-15-22(27)16-18-33)19-26(34)21-7-3-1-4-8-21/h1-14,22,27-28H,15-20H2/p+1 |
| InChIKey | IEKQNXRLOABNJY-UHFFFAOYSA-O |
| XLogP | 4.85 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.03 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|