C25H28F3N2O5S+ — CID 57345353
[(3R)-1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl] 2-phenyl-2-(2,2,2-trifluoroethylsulfonylamino)acetate (PubChem CID 57345353) has the molecular formula C25H28F3N2O5S+ and a molecular weight of 525.57 g/mol. Its IUPAC name is [(3R)-1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl] 2-phenyl-2-(2,2,2-trifluoroethylsulfonylamino)acetate.
| Compound Name | [(3R)-1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl] 2-phenyl-2-(2,2,2-trifluoroethylsulfonylamino)acetate |
|---|---|
| PubChem CID | 57345353 |
| Molecular Formula | C25H28F3N2O5S+ |
| Molecular Weight | 525.57 g/mol |
| Exact Mass | 525.17 |
| IUPAC Name | [(3R)-1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl] 2-phenyl-2-(2,2,2-trifluoroethylsulfonylamino)acetate |
| SMILES | O=C(C[N+]12CCC(CC1)[C@@H](OC(=O)C(NS(=O)(=O)CC(F)(F)F)c1ccccc1)C2)c1ccccc1 |
| InChI | InChI=1S/C25H28F3N2O5S/c26-25(27,28)17-36(33,34)29-23(20-9-5-2-6-10-20)24(32)35-22-16-30(13-11-19(22)12-14-30)15-21(31)18-7-3-1-4-8-18/h1-10,19,22-23,29H,11-17H2/q+1/t19?,22-,23?,30?/m0/s1 |
| InChIKey | LMYSVWZNISTYAS-QJRKAXJGSA-N |
| XLogP | 3.24 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.57 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|