C31H33N2O4+ — CID 59401141
[(3R)-1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl] 2-(2-acetylanilino)-2-phenylacetate (PubChem CID 59401141) has the molecular formula C31H33N2O4+ and a molecular weight of 497.62 g/mol. Its IUPAC name is [(3R)-1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl] 2-(2-acetylanilino)-2-phenylacetate.
| Compound Name | [(3R)-1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl] 2-(2-acetylanilino)-2-phenylacetate |
|---|---|
| PubChem CID | 59401141 |
| Molecular Formula | C31H33N2O4+ |
| Molecular Weight | 497.62 g/mol |
| Exact Mass | 497.24 |
| IUPAC Name | [(3R)-1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl] 2-(2-acetylanilino)-2-phenylacetate |
| SMILES | CC(=O)c1ccccc1NC(C(=O)O[C@H]1C[N+]2(CC(=O)c3ccccc3)CCC1CC2)c1ccccc1 |
| InChI | InChI=1S/C31H32N2O4/c1-22(34)26-14-8-9-15-27(26)32-30(25-12-6-3-7-13-25)31(36)37-29-21-33(18-16-24(29)17-19-33)20-28(35)23-10-4-2-5-11-23/h2-15,24,29-30H,16-21H2,1H3/p+1/t24?,29-,30?,33?/m0/s1 |
| InChIKey | FXHJMDKPFRTUQX-GYQVGWFTSA-O |
| XLogP | 5.08 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.62 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|