C32H35N2O5+ — CID 89053285
methyl 2-[[3-oxo-3-[[(3R)-1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl]oxy]-2-phenylpropyl]amino]benzoate (PubChem CID 89053285) has the molecular formula C32H35N2O5+ and a molecular weight of 527.64 g/mol. Its IUPAC name is methyl 2-[[3-oxo-3-[[(3R)-1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl]oxy]-2-phenylpropyl]amino]benzoate.
| Compound Name | methyl 2-[[3-oxo-3-[[(3R)-1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl]oxy]-2-phenylpropyl]amino]benzoate |
|---|---|
| PubChem CID | 89053285 |
| Molecular Formula | C32H35N2O5+ |
| Molecular Weight | 527.64 g/mol |
| Exact Mass | 527.25 |
| IUPAC Name | methyl 2-[[3-oxo-3-[[(3R)-1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl]oxy]-2-phenylpropyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NCC(C(=O)O[C@H]1C[N+]2(CC(=O)c3ccccc3)CCC1CC2)c1ccccc1 |
| InChI | InChI=1S/C32H34N2O5/c1-38-31(36)26-14-8-9-15-28(26)33-20-27(23-10-4-2-5-11-23)32(37)39-30-22-34(18-16-25(30)17-19-34)21-29(35)24-12-6-3-7-13-24/h2-15,25,27,30H,16-22H2,1H3/p+1/t25?,27?,30-,34?/m0/s1 |
| InChIKey | KAEHIFDDQHGANZ-YSHYAARXSA-O |
| XLogP | 4.70 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.64 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|